C23H26N4O4S — CID 24561374
2-[4-[2-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)acetyl]piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 24561374) has the molecular formula C23H26N4O4S and a molecular weight of 454.55 g/mol. Its IUPAC name is 2-[4-[2-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)acetyl]piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-[2-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)acetyl]piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 24561374 |
| Molecular Formula | C23H26N4O4S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 2-[4-[2-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)acetyl]piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | COc1ccc2c(c1)CCCN2CC(=O)N1CCN(S(=O)(=O)c2ccccc2C#N)CC1 |
| InChI | InChI=1S/C23H26N4O4S/c1-31-20-8-9-21-18(15-20)6-4-10-26(21)17-23(28)25-11-13-27(14-12-25)32(29,30)22-7-3-2-5-19(22)16-24/h2-3,5,7-9,15H,4,6,10-14,17H2,1H3 |
| InChIKey | CCZSOMAOXIEUQA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 93.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|