C17H24N2O3 — CID 56809620
2-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-1-(2-methylmorpholin-4-yl)ethanone (PubChem CID 56809620) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-1-(2-methylmorpholin-4-yl)ethanone.
| Compound Name | 2-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-1-(2-methylmorpholin-4-yl)ethanone |
|---|---|
| PubChem CID | 56809620 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 2-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-1-(2-methylmorpholin-4-yl)ethanone |
| SMILES | COc1ccc2c(c1)CCCN2CC(=O)N1CCOC(C)C1 |
| InChI | InChI=1S/C17H24N2O3/c1-13-11-19(8-9-22-13)17(20)12-18-7-3-4-14-10-15(21-2)5-6-16(14)18/h5-6,10,13H,3-4,7-9,11-12H2,1-2H3 |
| InChIKey | XDCDILAJPGAHFC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|