C16H21NO6 — CID 47069672
methyl 5-methoxy-2-[2-(2-methylmorpholin-4-yl)-2-oxoethoxy]benzoate (PubChem CID 47069672) has the molecular formula C16H21NO6 and a molecular weight of 323.35 g/mol. Its IUPAC name is methyl 5-methoxy-2-[2-(2-methylmorpholin-4-yl)-2-oxoethoxy]benzoate.
| Compound Name | methyl 5-methoxy-2-[2-(2-methylmorpholin-4-yl)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 47069672 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | methyl 5-methoxy-2-[2-(2-methylmorpholin-4-yl)-2-oxoethoxy]benzoate |
| SMILES | COC(=O)c1cc(OC)ccc1OCC(=O)N1CCOC(C)C1 |
| InChI | InChI=1S/C16H21NO6/c1-11-9-17(6-7-22-11)15(18)10-23-14-5-4-12(20-2)8-13(14)16(19)21-3/h4-5,8,11H,6-7,9-10H2,1-3H3 |
| InChIKey | POAGQWWEWLNHGR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |