C20H21N3O5 — CID 24561378
N-(1,3-benzodioxol-5-ylcarbamoyl)-2-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)acetamide (PubChem CID 24561378) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylcarbamoyl)-2-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylcarbamoyl)-2-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)acetamide |
|---|---|
| PubChem CID | 24561378 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylcarbamoyl)-2-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)acetamide |
| SMILES | COc1ccc2c(c1)CCCN2CC(=O)NC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H21N3O5/c1-26-15-5-6-16-13(9-15)3-2-8-23(16)11-19(24)22-20(25)21-14-4-7-17-18(10-14)28-12-27-17/h4-7,9-10H,2-3,8,11-12H2,1H3,(H2,21,22,24,25) |
| InChIKey | IFQVSXLIBVGKLT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|