C21H23F3N2O5 — CID 37202356
2-[6-(trifluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]-N-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 37202356) has the molecular formula C21H23F3N2O5 and a molecular weight of 440.42 g/mol. Its IUPAC name is 2-[6-(trifluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]-N-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-[6-(trifluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]-N-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 37202356 |
| Molecular Formula | C21H23F3N2O5 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2-[6-(trifluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]-N-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)CN2CCCc3cc(OC(F)(F)F)ccc32)cc(OC)c1OC |
| InChI | InChI=1S/C21H23F3N2O5/c1-28-17-10-14(11-18(29-2)20(17)30-3)25-19(27)12-26-8-4-5-13-9-15(6-7-16(13)26)31-21(22,23)24/h6-7,9-11H,4-5,8,12H2,1-3H3,(H,25,27) |
| InChIKey | FUAOFJSWQOQXSF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|