C19H19F3N2O4S — CID 37203473
N-(4-methylsulfonylphenyl)-2-[6-(trifluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]acetamide (PubChem CID 37203473) has the molecular formula C19H19F3N2O4S and a molecular weight of 428.43 g/mol. Its IUPAC name is N-(4-methylsulfonylphenyl)-2-[6-(trifluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]acetamide.
| Compound Name | N-(4-methylsulfonylphenyl)-2-[6-(trifluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]acetamide |
|---|---|
| PubChem CID | 37203473 |
| Molecular Formula | C19H19F3N2O4S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | N-(4-methylsulfonylphenyl)-2-[6-(trifluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]acetamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)CN2CCCc3cc(OC(F)(F)F)ccc32)cc1 |
| InChI | InChI=1S/C19H19F3N2O4S/c1-29(26,27)16-7-4-14(5-8-16)23-18(25)12-24-10-2-3-13-11-15(6-9-17(13)24)28-19(20,21)22/h4-9,11H,2-3,10,12H2,1H3,(H,23,25) |
| InChIKey | PQFNQVMPNKZQFM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|