C16H22N2O4S — CID 34948559
N-[(3R)-1,1-dioxothiolan-3-yl]-2-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)acetamide (PubChem CID 34948559) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-2-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)acetamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)acetamide |
|---|---|
| PubChem CID | 34948559 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)acetamide |
| SMILES | COc1ccc2c(c1)CCCN2CC(=O)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H22N2O4S/c1-22-14-4-5-15-12(9-14)3-2-7-18(15)10-16(19)17-13-6-8-23(20,21)11-13/h4-5,9,13H,2-3,6-8,10-11H2,1H3,(H,17,19)/t13-/m1/s1 |
| InChIKey | QTKRFYCMXQFSQK-CYBMUJFWSA-N |
| XLogP | 0.75 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|