C14H13NO4S2 — CID 146124471
1-thiophen-3-ylsulfonyl-3,4-dihydro-2H-quinoline-6-carboxylic acid (PubChem CID 146124471) has the molecular formula C14H13NO4S2 and a molecular weight of 323.39 g/mol. Its IUPAC name is 1-thiophen-3-ylsulfonyl-3,4-dihydro-2H-quinoline-6-carboxylic acid.
| Compound Name | 1-thiophen-3-ylsulfonyl-3,4-dihydro-2H-quinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 146124471 |
| Molecular Formula | C14H13NO4S2 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 1-thiophen-3-ylsulfonyl-3,4-dihydro-2H-quinoline-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)CCCN2S(=O)(=O)c1ccsc1 |
| InChI | InChI=1S/C14H13NO4S2/c16-14(17)11-3-4-13-10(8-11)2-1-6-15(13)21(18,19)12-5-7-20-9-12/h3-5,7-9H,1-2,6H2,(H,16,17) |
| InChIKey | CEZIOTIMVHOPAA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |