C21H23NO7S — CID 56556573
1-[4-(3-carboxypropoxy)-3-methylphenyl]sulfonyl-3,4-dihydro-2H-quinoline-6-carboxylic acid (PubChem CID 56556573) has the molecular formula C21H23NO7S and a molecular weight of 433.48 g/mol. Its IUPAC name is 1-[4-(3-carboxypropoxy)-3-methylphenyl]sulfonyl-3,4-dihydro-2H-quinoline-6-carboxylic acid.
| Compound Name | 1-[4-(3-carboxypropoxy)-3-methylphenyl]sulfonyl-3,4-dihydro-2H-quinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 56556573 |
| Molecular Formula | C21H23NO7S |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 1-[4-(3-carboxypropoxy)-3-methylphenyl]sulfonyl-3,4-dihydro-2H-quinoline-6-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)N2CCCc3cc(C(=O)O)ccc32)ccc1OCCCC(=O)O |
| InChI | InChI=1S/C21H23NO7S/c1-14-12-17(7-9-19(14)29-11-3-5-20(23)24)30(27,28)22-10-2-4-15-13-16(21(25)26)6-8-18(15)22/h6-9,12-13H,2-5,10-11H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | VPGGNYDDKIXHSL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|