C15H21NO3S — CID 102662224
1-(1-tert-butylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)ethanone (PubChem CID 102662224) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is 1-(1-tert-butylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)ethanone.
| Compound Name | 1-(1-tert-butylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)ethanone |
|---|---|
| PubChem CID | 102662224 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1-(1-tert-butylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)ethanone |
| SMILES | CC(=O)c1ccc2c(c1)CCCN2S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C15H21NO3S/c1-11(17)12-7-8-14-13(10-12)6-5-9-16(14)20(18,19)15(2,3)4/h7-8,10H,5-6,9H2,1-4H3 |
| InChIKey | MYBNBWIYMHAEKG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |