C14H17NO5S — CID 102662175
ethyl 2-[(5-acetyl-2,3-dihydroindol-1-yl)sulfonyl]acetate (PubChem CID 102662175) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is ethyl 2-[(5-acetyl-2,3-dihydroindol-1-yl)sulfonyl]acetate.
| Compound Name | ethyl 2-[(5-acetyl-2,3-dihydroindol-1-yl)sulfonyl]acetate |
|---|---|
| PubChem CID | 102662175 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | ethyl 2-[(5-acetyl-2,3-dihydroindol-1-yl)sulfonyl]acetate |
| SMILES | CCOC(=O)CS(=O)(=O)N1CCc2cc(C(C)=O)ccc21 |
| InChI | InChI=1S/C14H17NO5S/c1-3-20-14(17)9-21(18,19)15-7-6-12-8-11(10(2)16)4-5-13(12)15/h4-5,8H,3,6-7,9H2,1-2H3 |
| InChIKey | XDNZHDOIMWTDSN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |