C17H17NO3S — CID 110737439
1-[1-(2-methylphenyl)sulfonyl-2,3-dihydroindol-5-yl]ethanone (PubChem CID 110737439) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is 1-[1-(2-methylphenyl)sulfonyl-2,3-dihydroindol-5-yl]ethanone.
| Compound Name | 1-[1-(2-methylphenyl)sulfonyl-2,3-dihydroindol-5-yl]ethanone |
|---|---|
| PubChem CID | 110737439 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 1-[1-(2-methylphenyl)sulfonyl-2,3-dihydroindol-5-yl]ethanone |
| SMILES | CC(=O)c1ccc2c(c1)CCN2S(=O)(=O)c1ccccc1C |
| InChI | InChI=1S/C17H17NO3S/c1-12-5-3-4-6-17(12)22(20,21)18-10-9-15-11-14(13(2)19)7-8-16(15)18/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | GBCNEMKOKVKFOK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |