C10H12ClNO2S2 — CID 107650869
4-(2-chloroethylsulfonyl)-2,3-dihydro-1,4-benzothiazine (PubChem CID 107650869) has the molecular formula C10H12ClNO2S2 and a molecular weight of 277.80 g/mol. Its IUPAC name is 4-(2-chloroethylsulfonyl)-2,3-dihydro-1,4-benzothiazine.
| Compound Name | 4-(2-chloroethylsulfonyl)-2,3-dihydro-1,4-benzothiazine |
|---|---|
| PubChem CID | 107650869 |
| Molecular Formula | C10H12ClNO2S2 |
| Molecular Weight | 277.80 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | 4-(2-chloroethylsulfonyl)-2,3-dihydro-1,4-benzothiazine |
| SMILES | O=S(=O)(CCCl)N1CCSc2ccccc21 |
| InChI | InChI=1S/C10H12ClNO2S2/c11-5-8-16(13,14)12-6-7-15-10-4-2-1-3-9(10)12/h1-4H,5-8H2 |
| InChIKey | BURUBGPTVJXGDX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.80 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|