C12H16ClNO2S — CID 28704649
1-(4-chlorobutylsulfonyl)-2,3-dihydroindole (PubChem CID 28704649) has the molecular formula C12H16ClNO2S and a molecular weight of 273.79 g/mol. Its IUPAC name is 1-(4-chlorobutylsulfonyl)-2,3-dihydroindole.
| Compound Name | 1-(4-chlorobutylsulfonyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 28704649 |
| Molecular Formula | C12H16ClNO2S |
| Molecular Weight | 273.79 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 1-(4-chlorobutylsulfonyl)-2,3-dihydroindole |
| SMILES | O=S(=O)(CCCCCl)N1CCc2ccccc21 |
| InChI | InChI=1S/C12H16ClNO2S/c13-8-3-4-10-17(15,16)14-9-7-11-5-1-2-6-12(11)14/h1-2,5-6H,3-4,7-10H2 |
| InChIKey | JGPDGJWERVQRBX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.79 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|