C14H21ClN2O2S — CID 61248393
3-chloro-N-[3-(2,3-dihydroindol-1-yl)propyl]propane-1-sulfonamide (PubChem CID 61248393) has the molecular formula C14H21ClN2O2S and a molecular weight of 316.85 g/mol. Its IUPAC name is 3-chloro-N-[3-(2,3-dihydroindol-1-yl)propyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N-[3-(2,3-dihydroindol-1-yl)propyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 61248393 |
| Molecular Formula | C14H21ClN2O2S |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 3-chloro-N-[3-(2,3-dihydroindol-1-yl)propyl]propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCl)NCCCN1CCc2ccccc21 |
| InChI | InChI=1S/C14H21ClN2O2S/c15-8-3-12-20(18,19)16-9-4-10-17-11-7-13-5-1-2-6-14(13)17/h1-2,5-6,16H,3-4,7-12H2 |
| InChIKey | CVXBSNIAHKMFNO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|