C14H11Cl2NO2S2 — CID 112769096
4-(2,6-dichlorophenyl)sulfonyl-2,3-dihydro-1,4-benzothiazine (PubChem CID 112769096) has the molecular formula C14H11Cl2NO2S2 and a molecular weight of 360.29 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)sulfonyl-2,3-dihydro-1,4-benzothiazine.
| Compound Name | 4-(2,6-dichlorophenyl)sulfonyl-2,3-dihydro-1,4-benzothiazine |
|---|---|
| PubChem CID | 112769096 |
| Molecular Formula | C14H11Cl2NO2S2 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | 4-(2,6-dichlorophenyl)sulfonyl-2,3-dihydro-1,4-benzothiazine |
| SMILES | O=S(=O)(c1c(Cl)cccc1Cl)N1CCSc2ccccc21 |
| InChI | InChI=1S/C14H11Cl2NO2S2/c15-10-4-3-5-11(16)14(10)21(18,19)17-8-9-20-13-7-2-1-6-12(13)17/h1-7H,8-9H2 |
| InChIKey | WKPLVKDSOFKORD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |