About 6-[(6-chloro-4-oxo-2,3-dihydroquinolin-1-yl)sulfonyl]-3-methyl-1,3-benzoxazol-2-one
6-[(6-chloro-4-oxo-2,3-dihydroquinolin-1-yl)sulfonyl]-3-methyl-1,3-benzoxazol-2-one (PubChem CID 110635033) has the molecular formula C17H13ClN2O5S
and a molecular weight of 392.82 g/mol. Its IUPAC name is 6-[(6-chloro-4-oxo-2,3-dihydroquinolin-1-yl)sulfonyl]-3-methyl-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 6-[(6-chloro-4-oxo-2,3-dihydroquinolin-1-yl)sulfonyl]-3-methyl-1,3-benzoxazol-2-one |
| PubChem CID | 110635033 |
| Molecular Formula | C17H13ClN2O5S |
| Molecular Weight | 392.82 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | 6-[(6-chloro-4-oxo-2,3-dihydroquinolin-1-yl)sulfonyl]-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(S(=O)(=O)N3CCC(=O)c4cc(Cl)ccc43)ccc21 |
| InChI | InChI=1S/C17H13ClN2O5S/c1-19-14-5-3-11(9-16(14)25-17(19)22)26(23,24)20-7-6-15(21)12-8-10(18)2-4-13(12)20/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | WKMPWKBIWYWQBO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 89.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.82 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[(6-chloro-4-oxo-2,3-dihydroquinolin-1-yl)sulfonyl]-3-methyl-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(6-chloro-4-oxo-2,3-dihydroquinolin-1-yl)sulfonyl]-3-methyl-1,3-benzoxazol-2-one?
The IUPAC name of 6-[(6-chloro-4-oxo-2,3-dihydroquinolin-1-yl)sulfonyl]-3-methyl-1,3-benzoxazol-2-one (CID 110635033) is 6-[(6-chloro-4-oxo-2,3-dihydroquinolin-1-yl)sulfonyl]-3-methyl-1,3-benzoxazol-2-one.
What is the SMILES notation for 6-[(6-chloro-4-oxo-2,3-dihydroquinolin-1-yl)sulfonyl]-3-methyl-1,3-benzoxazol-2-one?
The canonical SMILES for 6-[(6-chloro-4-oxo-2,3-dihydroquinolin-1-yl)sulfonyl]-3-methyl-1,3-benzoxazol-2-one is Cn1c(=O)oc2cc(S(=O)(=O)N3CCC(=O)c4cc(Cl)ccc43)ccc21.
What is the InChIKey of 6-[(6-chloro-4-oxo-2,3-dihydroquinolin-1-yl)sulfonyl]-3-methyl-1,3-benzoxazol-2-one?
The InChIKey is WKMPWKBIWYWQBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClN2O5S/c1-19-14-5-3-11(9-16(14)25-17(19)22)26(23,24)20-7-6-15(21)12-8-10(18)2-4-13(12)20/h2-5,8-9H,6-7H2,1H3.
What are the key properties of 6-[(6-chloro-4-oxo-2,3-dihydroquinolin-1-yl)sulfonyl]-3-methyl-1,3-benzoxazol-2-one?
6-[(6-chloro-4-oxo-2,3-dihydroquinolin-1-yl)sulfonyl]-3-methyl-1,3-benzoxazol-2-one has a molecular weight of 392.82 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(6-chloro-4-oxo-2,3-dihydroquinolin-1-yl)sulfonyl]-3-methyl-1,3-benzoxazol-2-one is sourced from PubChem (CID 110635033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).