C11H12N2O5S — CID 55178205
6-(3-hydroxyazetidin-1-yl)sulfonyl-3-methyl-1,3-benzoxazol-2-one (PubChem CID 55178205) has the molecular formula C11H12N2O5S and a molecular weight of 284.29 g/mol. Its IUPAC name is 6-(3-hydroxyazetidin-1-yl)sulfonyl-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-(3-hydroxyazetidin-1-yl)sulfonyl-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 55178205 |
| Molecular Formula | C11H12N2O5S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 6-(3-hydroxyazetidin-1-yl)sulfonyl-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(S(=O)(=O)N3CC(O)C3)ccc21 |
| InChI | InChI=1S/C11H12N2O5S/c1-12-9-3-2-8(4-10(9)18-11(12)15)19(16,17)13-5-7(14)6-13/h2-4,7,14H,5-6H2,1H3 |
| InChIKey | CGXSFNVKEDANRG-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |