C13H17N3O4S — CID 43556311
6-(4-aminopiperidin-1-yl)sulfonyl-3-methyl-1,3-benzoxazol-2-one (PubChem CID 43556311) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 6-(4-aminopiperidin-1-yl)sulfonyl-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-(4-aminopiperidin-1-yl)sulfonyl-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 43556311 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 6-(4-aminopiperidin-1-yl)sulfonyl-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(S(=O)(=O)N3CCC(N)CC3)ccc21 |
| InChI | InChI=1S/C13H17N3O4S/c1-15-11-3-2-10(8-12(11)20-13(15)17)21(18,19)16-6-4-9(14)5-7-16/h2-3,8-9H,4-7,14H2,1H3 |
| InChIKey | YNBKAVFGUXUMKW-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |