C13H17N3O4S — CID 104976592
3-methyl-6-[(3S)-3-methylpiperazin-1-yl]sulfonyl-1,3-benzoxazol-2-one (PubChem CID 104976592) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 3-methyl-6-[(3S)-3-methylpiperazin-1-yl]sulfonyl-1,3-benzoxazol-2-one.
| Compound Name | 3-methyl-6-[(3S)-3-methylpiperazin-1-yl]sulfonyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 104976592 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 3-methyl-6-[(3S)-3-methylpiperazin-1-yl]sulfonyl-1,3-benzoxazol-2-one |
| SMILES | C[C@H]1CN(S(=O)(=O)c2ccc3c(c2)oc(=O)n3C)CCN1 |
| InChI | InChI=1S/C13H17N3O4S/c1-9-8-16(6-5-14-9)21(18,19)10-3-4-11-12(7-10)20-13(17)15(11)2/h3-4,7,9,14H,5-6,8H2,1-2H3/t9-/m0/s1 |
| InChIKey | DUMUOEJOVIXRLJ-VIFPVBQESA-N |
| XLogP | 0.11 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |