C13H16N2O5S — CID 110292469
3-methyl-6-(2-methylmorpholin-4-yl)sulfonyl-1,3-benzoxazol-2-one (PubChem CID 110292469) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is 3-methyl-6-(2-methylmorpholin-4-yl)sulfonyl-1,3-benzoxazol-2-one.
| Compound Name | 3-methyl-6-(2-methylmorpholin-4-yl)sulfonyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 110292469 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 3-methyl-6-(2-methylmorpholin-4-yl)sulfonyl-1,3-benzoxazol-2-one |
| SMILES | CC1CN(S(=O)(=O)c2ccc3c(c2)oc(=O)n3C)CCO1 |
| InChI | InChI=1S/C13H16N2O5S/c1-9-8-15(5-6-19-9)21(17,18)10-3-4-11-12(7-10)20-13(16)14(11)2/h3-4,7,9H,5-6,8H2,1-2H3 |
| InChIKey | ZVOHRHSADSATDB-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 81.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |