C19H20N2O5S — CID 110605467
3-methyl-6-(3-phenoxypiperidin-1-yl)sulfonyl-1,3-benzoxazol-2-one (PubChem CID 110605467) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is 3-methyl-6-(3-phenoxypiperidin-1-yl)sulfonyl-1,3-benzoxazol-2-one.
| Compound Name | 3-methyl-6-(3-phenoxypiperidin-1-yl)sulfonyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 110605467 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 3-methyl-6-(3-phenoxypiperidin-1-yl)sulfonyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(S(=O)(=O)N3CCCC(Oc4ccccc4)C3)ccc21 |
| InChI | InChI=1S/C19H20N2O5S/c1-20-17-10-9-16(12-18(17)26-19(20)22)27(23,24)21-11-5-8-15(13-21)25-14-6-3-2-4-7-14/h2-4,6-7,9-10,12,15H,5,8,11,13H2,1H3 |
| InChIKey | CRCVELAQOOIQDQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 81.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |