C15H15ClN2O4S2 — CID 47784424
1-(2-chlorophenyl)sulfonyl-N-methyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 47784424) has the molecular formula C15H15ClN2O4S2 and a molecular weight of 386.88 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfonyl-N-methyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-(2-chlorophenyl)sulfonyl-N-methyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 47784424 |
| Molecular Formula | C15H15ClN2O4S2 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 1-(2-chlorophenyl)sulfonyl-N-methyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc2c(c1)CCN2S(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C15H15ClN2O4S2/c1-17-23(19,20)12-6-7-14-11(10-12)8-9-18(14)24(21,22)15-5-3-2-4-13(15)16/h2-7,10,17H,8-9H2,1H3 |
| InChIKey | DUESJXGVUWEHNU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |