C18H19NO2S — CID 91287638
[2,3-dihydroindol-1-yl-oxo-(4-propylphenyl)-λ6-sulfanylidene]methanone (PubChem CID 91287638) has the molecular formula C18H19NO2S and a molecular weight of 313.42 g/mol. Its IUPAC name is [2,3-dihydroindol-1-yl-oxo-(4-propylphenyl)-λ6-sulfanylidene]methanone.
| Compound Name | [2,3-dihydroindol-1-yl-oxo-(4-propylphenyl)-λ6-sulfanylidene]methanone |
|---|---|
| PubChem CID | 91287638 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | [2,3-dihydroindol-1-yl-oxo-(4-propylphenyl)-λ6-sulfanylidene]methanone |
| SMILES | CCCc1ccc(S(=O)(=C=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C18H19NO2S/c1-2-5-15-8-10-17(11-9-15)22(21,14-20)19-13-12-16-6-3-4-7-18(16)19/h3-4,6-11H,2,5,12-13H2,1H3 |
| InChIKey | DERBGQYNPJXQLQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|