C10H11N3O7S3 — CID 51056626
8-hydroxynaphthalene-1,3,6-trisulfonamide (PubChem CID 51056626) has the molecular formula C10H11N3O7S3 and a molecular weight of 381.41 g/mol. Its IUPAC name is 8-hydroxynaphthalene-1,3,6-trisulfonamide.
| Compound Name | 8-hydroxynaphthalene-1,3,6-trisulfonamide |
|---|---|
| PubChem CID | 51056626 |
| Molecular Formula | C10H11N3O7S3 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | 8-hydroxynaphthalene-1,3,6-trisulfonamide |
| SMILES | NS(=O)(=O)c1cc(O)c2c(S(N)(=O)=O)cc(S(N)(=O)=O)cc2c1 |
| InChI | InChI=1S/C10H11N3O7S3/c11-21(15,16)6-1-5-2-7(22(12,17)18)4-9(23(13,19)20)10(5)8(14)3-6/h1-4,14H,(H2,11,15,16)(H2,12,17,18)(H2,13,19,20) |
| InChIKey | ZTOXJCHSZMIROI-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 200.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |