C12H13N2NaO8S3 — CID 23689885
sodium 8-hydroxy-3,6-bis(methylsulfamoyl)naphthalene-1-sulfonate (PubChem CID 23689885) has the molecular formula C12H13N2NaO8S3 and a molecular weight of 432.43 g/mol. Its IUPAC name is sodium 8-hydroxy-3,6-bis(methylsulfamoyl)naphthalene-1-sulfonate.
| Compound Name | sodium 8-hydroxy-3,6-bis(methylsulfamoyl)naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 23689885 |
| Molecular Formula | C12H13N2NaO8S3 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 431.97 |
| IUPAC Name | sodium 8-hydroxy-3,6-bis(methylsulfamoyl)naphthalene-1-sulfonate |
| SMILES | CNS(=O)(=O)c1cc(O)c2c(S(=O)(=O)[O-])cc(S(=O)(=O)NC)cc2c1.[Na+] |
| InChI | InChI=1S/C12H14N2O8S3.Na/c1-13-23(16,17)8-3-7-4-9(24(18,19)14-2)6-11(25(20,21)22)12(7)10(15)5-8;/h3-6,13-15H,1-2H3,(H,20,21,22);/q;+1/p-1 |
| InChIKey | RQFGHDHIQRSEJT-UHFFFAOYSA-M |
| XLogP | -3.73 |
| TPSA | 169.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | -3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|