C10H10N2O5S2 — CID 25047825
6-hydroxynaphthalene-1,3-disulfonamide (PubChem CID 25047825) has the molecular formula C10H10N2O5S2 and a molecular weight of 302.33 g/mol. Its IUPAC name is 6-hydroxynaphthalene-1,3-disulfonamide.
| Compound Name | 6-hydroxynaphthalene-1,3-disulfonamide |
|---|---|
| PubChem CID | 25047825 |
| Molecular Formula | C10H10N2O5S2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 6-hydroxynaphthalene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1cc(S(N)(=O)=O)c2ccc(O)cc2c1 |
| InChI | InChI=1S/C10H10N2O5S2/c11-18(14,15)8-4-6-3-7(13)1-2-9(6)10(5-8)19(12,16)17/h1-5,13H,(H2,11,14,15)(H2,12,16,17) |
| InChIKey | VBESAKLGXBJMOB-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |