About CID 164856832
CID 164856832 (PubChem CID 164856832) has the molecular formula C9H10BNO
and a molecular weight of 159.00 g/mol.
Molecular Properties
| Compound Name | CID 164856832 |
| PubChem CID | 164856832 |
| Molecular Formula | C9H10BNO |
| Molecular Weight | 159.00 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C)c(NC(C)=O)c1 |
| InChI | InChI=1S/C9H10BNO/c1-6-3-4-8(10)5-9(6)11-7(2)12/h3-5H,1-2H3,(H,11,12) |
| InChIKey | VMFOQCOSGUIRKH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.00 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 164856832 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164856832?
The IUPAC name of CID 164856832 (CID 164856832) is not available.
What is the SMILES notation for CID 164856832?
The canonical SMILES for CID 164856832 is [B]c1ccc(C)c(NC(C)=O)c1.
What is the InChIKey of CID 164856832?
The InChIKey is VMFOQCOSGUIRKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BNO/c1-6-3-4-8(10)5-9(6)11-7(2)12/h3-5H,1-2H3,(H,11,12).
What are the key properties of CID 164856832?
CID 164856832 has a molecular weight of 159.00 g/mol, XLogP of 0.75, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164856832 is sourced from PubChem (CID 164856832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).