About CID 22090216
CID 22090216 (PubChem CID 22090216) has the molecular formula C12H9B2NO
and a molecular weight of 204.83 g/mol.
Molecular Properties
| Compound Name | CID 22090216 |
| PubChem CID | 22090216 |
| Molecular Formula | C12H9B2NO |
| Molecular Weight | 204.83 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2cc(NC(C)=O)c([B])cc2c1 |
| InChI | InChI=1S/C12H9B2NO/c1-7(16)15-12-6-8-2-3-10(13)4-9(8)5-11(12)14/h2-6H,1H3,(H,15,16) |
| InChIKey | HXNIZDVAZGIIBI-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.83 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22090216 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22090216?
The IUPAC name of CID 22090216 (CID 22090216) is not available.
What is the SMILES notation for CID 22090216?
The canonical SMILES for CID 22090216 is [B]c1ccc2cc(NC(C)=O)c([B])cc2c1.
What is the InChIKey of CID 22090216?
The InChIKey is HXNIZDVAZGIIBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9B2NO/c1-7(16)15-12-6-8-2-3-10(13)4-9(8)5-11(12)14/h2-6H,1H3,(H,15,16).
What are the key properties of CID 22090216?
CID 22090216 has a molecular weight of 204.83 g/mol, XLogP of 0.39, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22090216 is sourced from PubChem (CID 22090216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).