C8H9BrClN3O2 — CID 50881297
2-bromo-4-chloro-1-N,1-N-dimethyl-6-nitrobenzene-1,3-diamine (PubChem CID 50881297) has the molecular formula C8H9BrClN3O2 and a molecular weight of 294.54 g/mol. Its IUPAC name is 2-bromo-4-chloro-1-N,1-N-dimethyl-6-nitrobenzene-1,3-diamine.
| Compound Name | 2-bromo-4-chloro-1-N,1-N-dimethyl-6-nitrobenzene-1,3-diamine |
|---|---|
| PubChem CID | 50881297 |
| Molecular Formula | C8H9BrClN3O2 |
| Molecular Weight | 294.54 g/mol |
| Exact Mass | 292.96 |
| IUPAC Name | 2-bromo-4-chloro-1-N,1-N-dimethyl-6-nitrobenzene-1,3-diamine |
| SMILES | CN(C)c1c([N+](=O)[O-])cc(Cl)c(N)c1Br |
| InChI | InChI=1S/C8H9BrClN3O2/c1-12(2)8-5(13(14)15)3-4(10)7(11)6(8)9/h3H,11H2,1-2H3 |
| InChIKey | OEOZNEYWQSYOPF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.54 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|