C9H5N3O6 — CID 4118754
4-amino-3,6-dinitrochromen-2-one (PubChem CID 4118754) has the molecular formula C9H5N3O6 and a molecular weight of 251.15 g/mol. Its IUPAC name is 4-amino-3,6-dinitrochromen-2-one.
| Compound Name | 4-amino-3,6-dinitrochromen-2-one |
|---|---|
| PubChem CID | 4118754 |
| Molecular Formula | C9H5N3O6 |
| Molecular Weight | 251.15 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | 4-amino-3,6-dinitrochromen-2-one |
| SMILES | Nc1c([N+](=O)[O-])c(=O)oc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C9H5N3O6/c10-7-5-3-4(11(14)15)1-2-6(5)18-9(13)8(7)12(16)17/h1-3H,10H2 |
| InChIKey | JMEGWCRHIMFPBR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 142.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.15 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|