C11H6F3NO5 — CID 163366356
6-nitro-2-(2,2,2-trifluoroethoxy)chromen-4-one (PubChem CID 163366356) has the molecular formula C11H6F3NO5 and a molecular weight of 289.17 g/mol. Its IUPAC name is 6-nitro-2-(2,2,2-trifluoroethoxy)chromen-4-one.
| Compound Name | 6-nitro-2-(2,2,2-trifluoroethoxy)chromen-4-one |
|---|---|
| PubChem CID | 163366356 |
| Molecular Formula | C11H6F3NO5 |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 6-nitro-2-(2,2,2-trifluoroethoxy)chromen-4-one |
| SMILES | O=c1cc(OCC(F)(F)F)oc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C11H6F3NO5/c12-11(13,14)5-19-10-4-8(16)7-3-6(15(17)18)1-2-9(7)20-10/h1-4H,5H2 |
| InChIKey | ASCYYYFBWYJMAW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 82.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|