C9H7ClF3NO5S — CID 113369538
3-methyl-5-nitro-2-(2,2,2-trifluoroethoxy)benzenesulfonyl chloride (PubChem CID 113369538) has the molecular formula C9H7ClF3NO5S and a molecular weight of 333.67 g/mol. Its IUPAC name is 3-methyl-5-nitro-2-(2,2,2-trifluoroethoxy)benzenesulfonyl chloride.
| Compound Name | 3-methyl-5-nitro-2-(2,2,2-trifluoroethoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 113369538 |
| Molecular Formula | C9H7ClF3NO5S |
| Molecular Weight | 333.67 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | 3-methyl-5-nitro-2-(2,2,2-trifluoroethoxy)benzenesulfonyl chloride |
| SMILES | Cc1cc([N+](=O)[O-])cc(S(=O)(=O)Cl)c1OCC(F)(F)F |
| InChI | InChI=1S/C9H7ClF3NO5S/c1-5-2-6(14(15)16)3-7(20(10,17)18)8(5)19-4-9(11,12)13/h2-3H,4H2,1H3 |
| InChIKey | XAYNVQMDBOPJDV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.67 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|