C18H17NO4 — CID 130411398
(2-oxo-3H-1,3-benzoxazol-6-yl) 4-tert-butylbenzoate (PubChem CID 130411398) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is (2-oxo-3H-1,3-benzoxazol-6-yl) 4-tert-butylbenzoate.
| Compound Name | (2-oxo-3H-1,3-benzoxazol-6-yl) 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 130411398 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (2-oxo-3H-1,3-benzoxazol-6-yl) 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)Oc2ccc3[nH]c(=O)oc3c2)cc1 |
| InChI | InChI=1S/C18H17NO4/c1-18(2,3)12-6-4-11(5-7-12)16(20)22-13-8-9-14-15(10-13)23-17(21)19-14/h4-10H,1-3H3,(H,19,21) |
| InChIKey | BTNWNWPERXOTNO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|