About (3-acetyl-2-methyl-1-benzofuran-5-yl) 4-tert-butylbenzoate
(3-acetyl-2-methyl-1-benzofuran-5-yl) 4-tert-butylbenzoate (PubChem CID 4860782) has the molecular formula C22H22O4
and a molecular weight of 350.41 g/mol. Its IUPAC name is (3-acetyl-2-methyl-1-benzofuran-5-yl) 4-tert-butylbenzoate.
Molecular Properties
| Compound Name | (3-acetyl-2-methyl-1-benzofuran-5-yl) 4-tert-butylbenzoate |
| PubChem CID | 4860782 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (3-acetyl-2-methyl-1-benzofuran-5-yl) 4-tert-butylbenzoate |
| SMILES | CC(=O)c1c(C)oc2ccc(OC(=O)c3ccc(C(C)(C)C)cc3)cc12 |
| InChI | InChI=1S/C22H22O4/c1-13(23)20-14(2)25-19-11-10-17(12-18(19)20)26-21(24)15-6-8-16(9-7-15)22(3,4)5/h6-12H,1-5H3 |
| InChIKey | JECUZLKUZZPEHO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-acetyl-2-methyl-1-benzofuran-5-yl) 4-tert-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetyl-2-methyl-1-benzofuran-5-yl) 4-tert-butylbenzoate?
The IUPAC name of (3-acetyl-2-methyl-1-benzofuran-5-yl) 4-tert-butylbenzoate (CID 4860782) is (3-acetyl-2-methyl-1-benzofuran-5-yl) 4-tert-butylbenzoate.
What is the SMILES notation for (3-acetyl-2-methyl-1-benzofuran-5-yl) 4-tert-butylbenzoate?
The canonical SMILES for (3-acetyl-2-methyl-1-benzofuran-5-yl) 4-tert-butylbenzoate is CC(=O)c1c(C)oc2ccc(OC(=O)c3ccc(C(C)(C)C)cc3)cc12.
What is the InChIKey of (3-acetyl-2-methyl-1-benzofuran-5-yl) 4-tert-butylbenzoate?
The InChIKey is JECUZLKUZZPEHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22O4/c1-13(23)20-14(2)25-19-11-10-17(12-18(19)20)26-21(24)15-6-8-16(9-7-15)22(3,4)5/h6-12H,1-5H3.
What are the key properties of (3-acetyl-2-methyl-1-benzofuran-5-yl) 4-tert-butylbenzoate?
(3-acetyl-2-methyl-1-benzofuran-5-yl) 4-tert-butylbenzoate has a molecular weight of 350.41 g/mol, XLogP of 5.46, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetyl-2-methyl-1-benzofuran-5-yl) 4-tert-butylbenzoate is sourced from PubChem (CID 4860782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).