C20H18O3 — CID 828334
6,7,8,9-tetrahydrodibenzofuran-2-yl 4-methylbenzoate (PubChem CID 828334) has the molecular formula C20H18O3 and a molecular weight of 306.36 g/mol. Its IUPAC name is 6,7,8,9-tetrahydrodibenzofuran-2-yl 4-methylbenzoate.
| Compound Name | 6,7,8,9-tetrahydrodibenzofuran-2-yl 4-methylbenzoate |
|---|---|
| PubChem CID | 828334 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 6,7,8,9-tetrahydrodibenzofuran-2-yl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc3oc4c(c3c2)CCCC4)cc1 |
| InChI | InChI=1S/C20H18O3/c1-13-6-8-14(9-7-13)20(21)22-15-10-11-19-17(12-15)16-4-2-3-5-18(16)23-19/h6-12H,2-5H2,1H3 |
| InChIKey | XOFHPFAXLSCLEK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|