C17H20O5S — CID 154749681
6,7,8,9-tetrahydrodibenzofuran-2-yl 2-methyl-3-methylsulfonylpropanoate (PubChem CID 154749681) has the molecular formula C17H20O5S and a molecular weight of 336.41 g/mol. Its IUPAC name is 6,7,8,9-tetrahydrodibenzofuran-2-yl 2-methyl-3-methylsulfonylpropanoate.
| Compound Name | 6,7,8,9-tetrahydrodibenzofuran-2-yl 2-methyl-3-methylsulfonylpropanoate |
|---|---|
| PubChem CID | 154749681 |
| Molecular Formula | C17H20O5S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 6,7,8,9-tetrahydrodibenzofuran-2-yl 2-methyl-3-methylsulfonylpropanoate |
| SMILES | CC(CS(C)(=O)=O)C(=O)Oc1ccc2oc3c(c2c1)CCCC3 |
| InChI | InChI=1S/C17H20O5S/c1-11(10-23(2,19)20)17(18)21-12-7-8-16-14(9-12)13-5-3-4-6-15(13)22-16/h7-9,11H,3-6,10H2,1-2H3 |
| InChIKey | PKGNQBDHBSVVPI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|