C20H26O4 — CID 154084767
2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)octanoic acid (PubChem CID 154084767) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is 2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)octanoic acid.
| Compound Name | 2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)octanoic acid |
|---|---|
| PubChem CID | 154084767 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)octanoic acid |
| SMILES | CCCCCCC(Oc1ccc2oc3c(c2c1)CCCC3)C(=O)O |
| InChI | InChI=1S/C20H26O4/c1-2-3-4-5-10-19(20(21)22)23-14-11-12-18-16(13-14)15-8-6-7-9-17(15)24-18/h11-13,19H,2-10H2,1H3,(H,21,22) |
| InChIKey | RJPHJNSOVWUNLF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|