C21H26O6 — CID 154125263
2-hexyl-2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)propanedioic acid (PubChem CID 154125263) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is 2-hexyl-2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)propanedioic acid.
| Compound Name | 2-hexyl-2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)propanedioic acid |
|---|---|
| PubChem CID | 154125263 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-hexyl-2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)propanedioic acid |
| SMILES | CCCCCCC(Oc1ccc2oc3c(c2c1)CCCC3)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C21H26O6/c1-2-3-4-7-12-21(19(22)23,20(24)25)27-14-10-11-18-16(13-14)15-8-5-6-9-17(15)26-18/h10-11,13H,2-9,12H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | LOKNQAJRNAVSBM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|