C23H24O5 — CID 8867276
[4-(2-methoxyethyl)phenyl] 2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetate (PubChem CID 8867276) has the molecular formula C23H24O5 and a molecular weight of 380.44 g/mol. Its IUPAC name is [4-(2-methoxyethyl)phenyl] 2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetate.
| Compound Name | [4-(2-methoxyethyl)phenyl] 2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetate |
|---|---|
| PubChem CID | 8867276 |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | [4-(2-methoxyethyl)phenyl] 2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetate |
| SMILES | COCCc1ccc(OC(=O)COc2ccc3oc4c(c3c2)CCCC4)cc1 |
| InChI | InChI=1S/C23H24O5/c1-25-13-12-16-6-8-17(9-7-16)27-23(24)15-26-18-10-11-22-20(14-18)19-4-2-3-5-21(19)28-22/h6-11,14H,2-5,12-13,15H2,1H3 |
| InChIKey | FSHLQUCXPGXWCN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|