C21H17NO4 — CID 8765893
(4-cyanophenyl) 2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetate (PubChem CID 8765893) has the molecular formula C21H17NO4 and a molecular weight of 347.37 g/mol. Its IUPAC name is (4-cyanophenyl) 2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetate.
| Compound Name | (4-cyanophenyl) 2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetate |
|---|---|
| PubChem CID | 8765893 |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (4-cyanophenyl) 2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetate |
| SMILES | N#Cc1ccc(OC(=O)COc2ccc3oc4c(c3c2)CCCC4)cc1 |
| InChI | InChI=1S/C21H17NO4/c22-12-14-5-7-15(8-6-14)25-21(23)13-24-16-9-10-20-18(11-16)17-3-1-2-4-19(17)26-20/h5-11H,1-4,13H2 |
| InChIKey | UTYFROMOKUQRGJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 72.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|