About (3-acetyl-2-methyl-1-benzofuran-5-yl) 3-bromobenzoate
(3-acetyl-2-methyl-1-benzofuran-5-yl) 3-bromobenzoate (PubChem CID 1223275) has the molecular formula C18H13BrO4
and a molecular weight of 373.20 g/mol. Its IUPAC name is (3-acetyl-2-methyl-1-benzofuran-5-yl) 3-bromobenzoate.
Molecular Properties
| Compound Name | (3-acetyl-2-methyl-1-benzofuran-5-yl) 3-bromobenzoate |
| PubChem CID | 1223275 |
| Molecular Formula | C18H13BrO4 |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | (3-acetyl-2-methyl-1-benzofuran-5-yl) 3-bromobenzoate |
| SMILES | CC(=O)c1c(C)oc2ccc(OC(=O)c3cccc(Br)c3)cc12 |
| InChI | InChI=1S/C18H13BrO4/c1-10(20)17-11(2)22-16-7-6-14(9-15(16)17)23-18(21)12-4-3-5-13(19)8-12/h3-9H,1-2H3 |
| InChIKey | IRGHBYQSQRLPLQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-acetyl-2-methyl-1-benzofuran-5-yl) 3-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetyl-2-methyl-1-benzofuran-5-yl) 3-bromobenzoate?
The IUPAC name of (3-acetyl-2-methyl-1-benzofuran-5-yl) 3-bromobenzoate (CID 1223275) is (3-acetyl-2-methyl-1-benzofuran-5-yl) 3-bromobenzoate.
What is the SMILES notation for (3-acetyl-2-methyl-1-benzofuran-5-yl) 3-bromobenzoate?
The canonical SMILES for (3-acetyl-2-methyl-1-benzofuran-5-yl) 3-bromobenzoate is CC(=O)c1c(C)oc2ccc(OC(=O)c3cccc(Br)c3)cc12.
What is the InChIKey of (3-acetyl-2-methyl-1-benzofuran-5-yl) 3-bromobenzoate?
The InChIKey is IRGHBYQSQRLPLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13BrO4/c1-10(20)17-11(2)22-16-7-6-14(9-15(16)17)23-18(21)12-4-3-5-13(19)8-12/h3-9H,1-2H3.
What are the key properties of (3-acetyl-2-methyl-1-benzofuran-5-yl) 3-bromobenzoate?
(3-acetyl-2-methyl-1-benzofuran-5-yl) 3-bromobenzoate has a molecular weight of 373.20 g/mol, XLogP of 4.93, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetyl-2-methyl-1-benzofuran-5-yl) 3-bromobenzoate is sourced from PubChem (CID 1223275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).