About (2-acetylphenyl) 3-bromobenzoate
(2-acetylphenyl) 3-bromobenzoate (PubChem CID 50850159) has the molecular formula C15H11BrO3
and a molecular weight of 319.15 g/mol. Its IUPAC name is (2-acetylphenyl) 3-bromobenzoate.
Molecular Properties
| Compound Name | (2-acetylphenyl) 3-bromobenzoate |
| PubChem CID | 50850159 |
| Molecular Formula | C15H11BrO3 |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | (2-acetylphenyl) 3-bromobenzoate |
| SMILES | CC(=O)c1ccccc1OC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H11BrO3/c1-10(17)13-7-2-3-8-14(13)19-15(18)11-5-4-6-12(16)9-11/h2-9H,1H3 |
| InChIKey | FCJFMWDYAIVJIL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-acetylphenyl) 3-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetylphenyl) 3-bromobenzoate?
The IUPAC name of (2-acetylphenyl) 3-bromobenzoate (CID 50850159) is (2-acetylphenyl) 3-bromobenzoate.
What is the SMILES notation for (2-acetylphenyl) 3-bromobenzoate?
The canonical SMILES for (2-acetylphenyl) 3-bromobenzoate is CC(=O)c1ccccc1OC(=O)c1cccc(Br)c1.
What is the InChIKey of (2-acetylphenyl) 3-bromobenzoate?
The InChIKey is FCJFMWDYAIVJIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11BrO3/c1-10(17)13-7-2-3-8-14(13)19-15(18)11-5-4-6-12(16)9-11/h2-9H,1H3.
What are the key properties of (2-acetylphenyl) 3-bromobenzoate?
(2-acetylphenyl) 3-bromobenzoate has a molecular weight of 319.15 g/mol, XLogP of 3.87, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetylphenyl) 3-bromobenzoate is sourced from PubChem (CID 50850159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).