About (2-acetyl-4-ethylphenyl) benzoate
(2-acetyl-4-ethylphenyl) benzoate (PubChem CID 11832389) has the molecular formula C17H16O3
and a molecular weight of 268.31 g/mol. Its IUPAC name is (2-acetyl-4-ethylphenyl) benzoate.
Molecular Properties
| Compound Name | (2-acetyl-4-ethylphenyl) benzoate |
| PubChem CID | 11832389 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (2-acetyl-4-ethylphenyl) benzoate |
| SMILES | CCc1ccc(OC(=O)c2ccccc2)c(C(C)=O)c1 |
| InChI | InChI=1S/C17H16O3/c1-3-13-9-10-16(15(11-13)12(2)18)20-17(19)14-7-5-4-6-8-14/h4-11H,3H2,1-2H3 |
| InChIKey | XTKPZGMSVULKHZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-acetyl-4-ethylphenyl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetyl-4-ethylphenyl) benzoate?
The IUPAC name of (2-acetyl-4-ethylphenyl) benzoate (CID 11832389) is (2-acetyl-4-ethylphenyl) benzoate.
What is the SMILES notation for (2-acetyl-4-ethylphenyl) benzoate?
The canonical SMILES for (2-acetyl-4-ethylphenyl) benzoate is CCc1ccc(OC(=O)c2ccccc2)c(C(C)=O)c1.
What is the InChIKey of (2-acetyl-4-ethylphenyl) benzoate?
The InChIKey is XTKPZGMSVULKHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O3/c1-3-13-9-10-16(15(11-13)12(2)18)20-17(19)14-7-5-4-6-8-14/h4-11H,3H2,1-2H3.
What are the key properties of (2-acetyl-4-ethylphenyl) benzoate?
(2-acetyl-4-ethylphenyl) benzoate has a molecular weight of 268.31 g/mol, XLogP of 3.67, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetyl-4-ethylphenyl) benzoate is sourced from PubChem (CID 11832389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).