About (2-acetylphenyl) 4-heptylbenzoate
(2-acetylphenyl) 4-heptylbenzoate (PubChem CID 11724708) has the molecular formula C22H26O3
and a molecular weight of 338.45 g/mol. Its IUPAC name is (2-acetylphenyl) 4-heptylbenzoate.
Molecular Properties
| Compound Name | (2-acetylphenyl) 4-heptylbenzoate |
| PubChem CID | 11724708 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (2-acetylphenyl) 4-heptylbenzoate |
| SMILES | CCCCCCCc1ccc(C(=O)Oc2ccccc2C(C)=O)cc1 |
| InChI | InChI=1S/C22H26O3/c1-3-4-5-6-7-10-18-13-15-19(16-14-18)22(24)25-21-12-9-8-11-20(21)17(2)23/h8-9,11-16H,3-7,10H2,1-2H3 |
| InChIKey | JHKPWGGRQYHORF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-acetylphenyl) 4-heptylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetylphenyl) 4-heptylbenzoate?
The IUPAC name of (2-acetylphenyl) 4-heptylbenzoate (CID 11724708) is (2-acetylphenyl) 4-heptylbenzoate.
What is the SMILES notation for (2-acetylphenyl) 4-heptylbenzoate?
The canonical SMILES for (2-acetylphenyl) 4-heptylbenzoate is CCCCCCCc1ccc(C(=O)Oc2ccccc2C(C)=O)cc1.
What is the InChIKey of (2-acetylphenyl) 4-heptylbenzoate?
The InChIKey is JHKPWGGRQYHORF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26O3/c1-3-4-5-6-7-10-18-13-15-19(16-14-18)22(24)25-21-12-9-8-11-20(21)17(2)23/h8-9,11-16H,3-7,10H2,1-2H3.
What are the key properties of (2-acetylphenyl) 4-heptylbenzoate?
(2-acetylphenyl) 4-heptylbenzoate has a molecular weight of 338.45 g/mol, XLogP of 5.62, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetylphenyl) 4-heptylbenzoate is sourced from PubChem (CID 11724708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).