About (4-bromo-2-formylphenyl) 3-bromobenzoate
(4-bromo-2-formylphenyl) 3-bromobenzoate (PubChem CID 4766842) has the molecular formula C14H8Br2O3
and a molecular weight of 384.02 g/mol. Its IUPAC name is (4-bromo-2-formylphenyl) 3-bromobenzoate.
Molecular Properties
| Compound Name | (4-bromo-2-formylphenyl) 3-bromobenzoate |
| PubChem CID | 4766842 |
| Molecular Formula | C14H8Br2O3 |
| Molecular Weight | 384.02 g/mol |
| Exact Mass | 381.88 |
| IUPAC Name | (4-bromo-2-formylphenyl) 3-bromobenzoate |
| SMILES | O=Cc1cc(Br)ccc1OC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H8Br2O3/c15-11-3-1-2-9(6-11)14(18)19-13-5-4-12(16)7-10(13)8-17/h1-8H |
| InChIKey | FJKDQXIWLXCMST-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.02 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-2-formylphenyl) 3-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2-formylphenyl) 3-bromobenzoate?
The IUPAC name of (4-bromo-2-formylphenyl) 3-bromobenzoate (CID 4766842) is (4-bromo-2-formylphenyl) 3-bromobenzoate.
What is the SMILES notation for (4-bromo-2-formylphenyl) 3-bromobenzoate?
The canonical SMILES for (4-bromo-2-formylphenyl) 3-bromobenzoate is O=Cc1cc(Br)ccc1OC(=O)c1cccc(Br)c1.
What is the InChIKey of (4-bromo-2-formylphenyl) 3-bromobenzoate?
The InChIKey is FJKDQXIWLXCMST-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Br2O3/c15-11-3-1-2-9(6-11)14(18)19-13-5-4-12(16)7-10(13)8-17/h1-8H.
What are the key properties of (4-bromo-2-formylphenyl) 3-bromobenzoate?
(4-bromo-2-formylphenyl) 3-bromobenzoate has a molecular weight of 384.02 g/mol, XLogP of 4.24, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2-formylphenyl) 3-bromobenzoate is sourced from PubChem (CID 4766842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).