C18H12N2O5 — CID 10215302
(E)-3-(4-hydroxy-3-methoxyphenyl)-2-(2-oxo-3H-1,3-benzoxazole-5-carbonyl)prop-2-enenitrile (PubChem CID 10215302) has the molecular formula C18H12N2O5 and a molecular weight of 336.30 g/mol. Its IUPAC name is (E)-3-(4-hydroxy-3-methoxyphenyl)-2-(2-oxo-3H-1,3-benzoxazole-5-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-(4-hydroxy-3-methoxyphenyl)-2-(2-oxo-3H-1,3-benzoxazole-5-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 10215302 |
| Molecular Formula | C18H12N2O5 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | (E)-3-(4-hydroxy-3-methoxyphenyl)-2-(2-oxo-3H-1,3-benzoxazole-5-carbonyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(\C#N)C(=O)c2ccc3oc(=O)[nH]c3c2)ccc1O |
| InChI | InChI=1S/C18H12N2O5/c1-24-16-7-10(2-4-14(16)21)6-12(9-19)17(22)11-3-5-15-13(8-11)20-18(23)25-15/h2-8,21H,1H3,(H,20,23)/b12-6+ |
| InChIKey | KFIAECVQFGNRKO-WUXMJOGZSA-N |
| XLogP | 2.63 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|