C20H15Cl2NO5 — CID 91294929
benzene-1,4-dicarbonyl chloride;2-[(4-hydroxy-3-methoxyphenyl)methylidene]-3-oxobutanenitrile (PubChem CID 91294929) has the molecular formula C20H15Cl2NO5 and a molecular weight of 420.25 g/mol. Its IUPAC name is benzene-1,4-dicarbonyl chloride;2-[(4-hydroxy-3-methoxyphenyl)methylidene]-3-oxobutanenitrile.
| Compound Name | benzene-1,4-dicarbonyl chloride;2-[(4-hydroxy-3-methoxyphenyl)methylidene]-3-oxobutanenitrile |
|---|---|
| PubChem CID | 91294929 |
| Molecular Formula | C20H15Cl2NO5 |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | benzene-1,4-dicarbonyl chloride;2-[(4-hydroxy-3-methoxyphenyl)methylidene]-3-oxobutanenitrile |
| SMILES | COc1cc(C=C(C#N)C(C)=O)ccc1O.O=C(Cl)c1ccc(C(=O)Cl)cc1 |
| InChI | InChI=1S/C12H11NO3.C8H4Cl2O2/c1-8(14)10(7-13)5-9-3-4-11(15)12(6-9)16-2;9-7(11)5-1-2-6(4-3-5)8(10)12/h3-6,15H,1-2H3;1-4H |
| InChIKey | PTGJBTUXHCIBKF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|