C23H18BrFO3S2 — CID 52948275
(E)-1-(4-bromophenyl)-2-[(4-fluorophenyl)methylsulfonyl]-3-(4-methylsulfanylphenyl)prop-2-en-1-one (PubChem CID 52948275) has the molecular formula C23H18BrFO3S2 and a molecular weight of 505.43 g/mol. Its IUPAC name is (E)-1-(4-bromophenyl)-2-[(4-fluorophenyl)methylsulfonyl]-3-(4-methylsulfanylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromophenyl)-2-[(4-fluorophenyl)methylsulfonyl]-3-(4-methylsulfanylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 52948275 |
| Molecular Formula | C23H18BrFO3S2 |
| Molecular Weight | 505.43 g/mol |
| Exact Mass | 503.99 |
| IUPAC Name | (E)-1-(4-bromophenyl)-2-[(4-fluorophenyl)methylsulfonyl]-3-(4-methylsulfanylphenyl)prop-2-en-1-one |
| SMILES | CSc1ccc(/C=C(\C(=O)c2ccc(Br)cc2)S(=O)(=O)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H18BrFO3S2/c1-29-21-12-4-16(5-13-21)14-22(23(26)18-6-8-19(24)9-7-18)30(27,28)15-17-2-10-20(25)11-3-17/h2-14H,15H2,1H3/b22-14+ |
| InChIKey | APZXXIYYBFLEID-HYARGMPZSA-N |
| XLogP | 6.15 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.43 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|