C22H15BrClNO5S — CID 68543546
(E)-2-[(4-bromophenyl)methylsulfanyl]-1-(5-chloro-2-hydroxyphenyl)-3-(4-hydroxy-3-nitrophenyl)prop-2-en-1-one (PubChem CID 68543546) has the molecular formula C22H15BrClNO5S and a molecular weight of 520.79 g/mol. Its IUPAC name is (E)-2-[(4-bromophenyl)methylsulfanyl]-1-(5-chloro-2-hydroxyphenyl)-3-(4-hydroxy-3-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-2-[(4-bromophenyl)methylsulfanyl]-1-(5-chloro-2-hydroxyphenyl)-3-(4-hydroxy-3-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 68543546 |
| Molecular Formula | C22H15BrClNO5S |
| Molecular Weight | 520.79 g/mol |
| Exact Mass | 518.95 |
| IUPAC Name | (E)-2-[(4-bromophenyl)methylsulfanyl]-1-(5-chloro-2-hydroxyphenyl)-3-(4-hydroxy-3-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(/C(=C\c1ccc(O)c([N+](=O)[O-])c1)SCc1ccc(Br)cc1)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C22H15BrClNO5S/c23-15-4-1-13(2-5-15)12-31-21(22(28)17-11-16(24)6-8-19(17)26)10-14-3-7-20(27)18(9-14)25(29)30/h1-11,26-27H,12H2/b21-10+ |
| InChIKey | LBLZEYYLYIZZGS-UFFVCSGVSA-N |
| XLogP | 6.58 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.79 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|